Content deleted Content added
m Robot - Removing category E numbers per CFD at Wikipedia:Categories for discussion/Log/2011 December 19. |
fix mistake |
||
(43 intermediate revisions by 29 users not shown) | |||
Line 1:
{{chembox
| Watchedfields = changed
| verifiedrevid = 443736114
| Name
| ImageFile
| ImageSize
| ImageName
| ImageFile1
| ImageSize1
| IUPACName = <small>D</small>-''erythro''-Hex-2-enono-1,4-lactone
|
| OtherNames
| Section1 = {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 16736142
| UNII_Ref = {{fdacite|correct|FDA}}
Line 19 ⟶ 20:
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 89-65-6
|
|
| ChEBI = 51438
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 28 ⟶ 29:
| SMILES = OC=1[C@H](OC(=O)C=1O)[C@H](O)CO
}}
| Section2 = {{Chembox Properties
| C=6 | H=8 | O=6
|
| MeltingPtC = 164 to 172
|
|
}}
| Section3 = {{Chembox Hazards
| NFPA-H = 1
| NFPA-F = 1
| NFPA-R = 0
}}
| Section6 = {{Chembox Related
| OtherCations = [[Calcium erythorbate]], [[sodium erythorbate]], [[potassium erythorbate]]
}}
}}
'''Erythorbic acid'''
Clinical trials have been conducted to investigate aspects of the nutritional value of erythorbic acid. One such trial investigated the effects of erythorbic acid on vitamin C metabolism in young women; no effect on vitamin C uptake or clearance from the body was found.<ref>{{cite journal | title = Effects of erythorbic acid on vitamin C metabolism in young women | last = Sauberlich | first = HE |
Since the U.S. Food and Drug Administration banned the use of [[sulfites]] as a [[preservative]] in foods intended to be eaten fresh (such as salad bar ingredients), the use of erythorbic acid as a food preservative has increased.
It is also used as a preservative in cured meats and frozen vegetables.<ref>{{cite book | author = Hui YH | title = Handbook of Food Science, Technology and Engineering | publisher = CRC Press | year = 2006 | isbn = 0-8493-9848-7 | pages = 83–32 }}<!--page numbers don't make sense--></ref>
It was first synthesized in 1933 by the German chemists Kurt Maurer and Bruno Schiedt.<ref>See:
* {{cite journal | last1 = Maurer | first1 = Kurt | last2 = Schiedt | first2 = Bruno | date = August 2, 1933 | title = "Die Darstellung einer Säure C<sub>6</sub>H<sub>8</sub>O<sub>6</sub> aus Glucose, die in ihrer Reduktionskraft der Ascorbinsäure gleicht (Vorläuf. Mitteil.)" (The preparation of an acid C<sub>6</sub>H<sub>8</sub>O<sub>6</sub> from glucose, which equals ascorbic acid in its reducing power (preliminary report)) | url = | journal = Berichte der Deutschen Chemischen Gesellschaft | volume = 66 | issue = 8| pages = 1054–1057 | doi = 10.1002/cber.19330660807 }}
* {{cite journal | last1 = Maurer | first1 = Kurt | last2 = Schiedt | first2 = Bruno | date = July 4, 1934 | title = "Zur Darstellung des Iso-Vitamins C (''d''-Arabo-ascorbinsäure) (II. Mitteil.)" (On the preparation of iso-vitamin C (''d''-arabo-ascorbic acid) (2nd report)) | url = | journal = Berichte der Deutschen Chemischen Gesellschaft | volume = 67 | issue = 7| pages = 1239–1241 | doi = 10.1002/cber.19340670724 }}</ref><ref>See also:
* {{cite journal | last1 = Ohle | first1 = Heinz | last2 = Erlbach | first2 = Heinz | last3 = Carls | first3 = Herbert | date = February 7, 1934 | title = "''d''-Gluco-saccharosonsäure, ein Isomeres der Ascorbinsäure, I. Mitteil.: Darstellung und Eigenschaften" (''d''-Gluco-saccharosonic acid, an isomer of ascorbic acid, 1st report: preparation and properties) | url = | journal = Berichte der Deutschen Chemischen Gesellschaft | volume = 67 | issue = 2| pages = 324–332 | doi = 10.1002/cber.19340670235 }}
* {{cite journal | last1 = Baird | first1 = D. K. | last2 = Haworth | first2 = W. N. | last3 = Herbert | first3 = R. W. | last4 = Hirst | first4 = E. L. | last5 = Smith | first5 = F. | last6 = Stacey | first6 = M. | year = 1934 | title = Ascorbic acid and synthetic analogues | url = | journal = Journal of the Chemical Society | volume = | issue = | pages = 63–67 | doi = 10.1039/JR9340000062 }}
* {{cite journal | last1 = Reichstein | first1 = T. | last2 = Grüssner | first2 = A. | last3 = Oppenauer | first3 = R. | year = 1934 | title = "Synthese der Ascorbinsäure und verwandter Verbindungen nach der Oson-Blausäure-Methode"(Synthesis of ascorbic acid and related compounds via the ozone-hydrogen cyanide method) | url = | journal = Helvetica Chimica Acta | volume = 17 | issue = | pages = 510–520 | doi = 10.1002/hlca.19340170157 }}</ref>
==References==
{{reflist}}
[[Category:Food antioxidants]]
[[Category:E-number additives]]
[[Category:Substances discovered in the 1930s]]
|