Oxyphenonium bromide: Difference between revisions
Content deleted Content added
FV alternate (talk | contribs) m moved Oxyphenonium to Oxyphenonium bromide: moving to International Nonproprietary Name as per Wikipedia:WikiProject Pharmacology/Style guide#Drug pages to use INN: INN includes the counterion |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(42 intermediate revisions by 22 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| IUPAC_name = |
|||
| Watchedfields = changed |
|||
| image = |
|||
| verifiedrevid = 379646056 |
|||
⚫ | |||
| IUPAC_name = 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-''N,N''-diethyl-''N''-methylethanaminium bromide |
|||
⚫ | |||
| image = Oxyphenonium bromide.png |
|||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| |
| tradename = |
||
| Drugs.com = {{drugs.com|international|oxyphenonium-bromide}} |
|||
| chemical_formula = C21H34NO3+ |
|||
⚫ | |||
| molecular_weight = 348.49956 |
|||
⚫ | |||
⚫ | |||
| |
| pregnancy_category = |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| legal_status = |
|||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
| protein_bound = |
|||
⚫ | |||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion |
| excretion = |
||
<!--Identifiers--> |
|||
⚫ | |||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
⚫ | |||
⚫ | |||
| pregnancy_category= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
⚫ | |||
| |
| DrugBank = |
||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
⚫ | |||
| UNII = S9421HWB3Z |
|||
| KEGG_Ref = {{keggcite|changed|kegg}} |
|||
| KEGG = D06877 |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1200906 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 5546 |
|||
<!--Chemical data--> |
|||
| C=21 | H=34 | Br=1 | N=1 | O=3 |
|||
| smiles = OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-] |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C21H34NO3.BrH/c1-4-22(3,5-2)16-17-25-20(23)21(24,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19,24H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = UKLQXHUGTKWPSR-UHFFFAOYSA-M |
|||
}} |
}} |
||
'''Oxyphenonium''' is an [[antimuscarinic]]. |
|||
'''Oxyphenonium bromide''' is an [[antimuscarinic]] drug. It is used to treat [[gastric ulcer|gastric]] and [[duodenal ulcer]]s and to relieve visceral spasms.<ref>{{cite web | url = https://www.drugbank.ca/drugs/DB00219 | title = Oxyphenonium | publisher = [[DrugBank]]}}</ref> |
|||
{{pharmacology-stub}} |
|||
==References== |
|||
{{Reflist}} |
|||
{{Drugs for functional gastrointestinal disorders}} |
{{Drugs for functional gastrointestinal disorders}} |
||
{{Muscarinic acetylcholine receptor modulators}} |
|||
[[Category:Muscarinic antagonists]] |
|||
[[Category:Quaternary ammonium compounds]] |
|||
[[Category:Bromides]] |
|||
[[Category:Tertiary alcohols]] |
|||
[[Category:Carboxylate esters]] |
|||
{{gastrointestinal-drug-stub}} |
Latest revision as of 11:09, 23 January 2023
Clinical data | |
---|---|
AHFS/Drugs.com | International Drug Names |
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEMBL | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.000.010 |
Chemical and physical data | |
Formula | C21H34BrNO3 |
Molar mass | 428.411 g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Oxyphenonium bromide is an antimuscarinic drug. It is used to treat gastric and duodenal ulcers and to relieve visceral spasms.[1]
References[edit]