Oxyphenonium bromide: Difference between revisions

Oxyphenonium bromide
Clinical data
AHFS/Drugs.com	International Drug Names
ATC code	A03AB03 (WHO) ;
Identifiers
	IUPAC name 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-N,N-diethyl-N-methylethanaminium bromide;
CAS Number	50-10-2 ;
PubChem CID	5748;
ChemSpider	5546 ;
UNII	S9421HWB3Z;
KEGG	D06877 ;
ChEMBL	ChEMBL1200906 ;
CompTox Dashboard (EPA)	DTXSID4045632 ;
ECHA InfoCard	100.000.010
Chemical and physical data
Formula	C21H34BrNO3
Molar mass	428.411 g·mol−1
3D model (JSmol)	Interactive image;
	SMILES OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-];
	InChI InChI=1S/C21H34NO3.BrH/c1-4-22(3,5-2)16-17-25-20(23)21(24,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19,24H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1 ; Key:UKLQXHUGTKWPSR-UHFFFAOYSA-M ;
	(what is this?) (verify)

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

Inline

Latest revision as of 11:09, 23 January 2023

Oxyphenonium bromide is an antimuscarinic drug. It is used to treat gastric and duodenal ulcers and to relieve visceral spasms.^[1]

References[edit]

^ "Oxyphenonium". DrugBank.

This drug article relating to the gastrointestinal system is a stub. You can help Wikipedia by expanding it.

[1] "Oxyphenonium". DrugBank.

[1]

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
 {{Drugbox
+| Verifiedfields = changed
-| IUPAC_name        = 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-''N,N''-diethyl-''N''-methylethanaminium bromide
+| Watchedfields = changed
-| image             = Oxyphenonium bromide.png
+| verifiedrevid = 379646056
-| CAS_number        = 50-10-2
+| IUPAC_name = 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-''N,N''-diethyl-''N''-methylethanaminium bromide
-| ATC_prefix        = A03
+| image = Oxyphenonium bromide.png
-| ATC_suffix        = AB03
+<!--Clinical data-->
-| PubChem           = 5748
-| DrugBank          =
+| tradename =
+| Drugs.com = {{drugs.com|international|oxyphenonium-bromide}}
-| smiles = OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-]
+| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->
-| C=21|H=34|Br=1|N=1|O=3
+| pregnancy_US = <!-- A / B            / C / D / X -->
-| molecular_weight  = 428.40 g/mol
-| bioavailability   =
+| pregnancy_category =
+| legal_AUえーゆー = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
-| protein_bound     =
+| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
-| metabolism        =
+| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
+| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| protein_bound =
+| metabolism =
 | elimination_half-life =
-| excretion         =
+| excretion =
+<!--Identifiers-->
-| pregnancy_AUえーゆー      =  <!-- A / B1 / B2 / B3 / C / D / X -->
+| CAS_number_Ref = {{cascite|correct|??}}
-| pregnancy_US      =  <!-- A / B            / C / D / X -->
+| CAS_number = 50-10-2
-| pregnancy_category=
+| ATC_prefix = A03
-| legal_AUえーゆー =  <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
+| ATC_suffix = AB03
-| legal_CA =  <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
+| PubChem = 5748
-| legal_UK =  <!-- GSL, P, POM, CD, or Class A, B, C -->
+| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
-| legal_US =  <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
-| legal_status      =
+| DrugBank =
+| UNII_Ref = {{fdacite|changed|FDA}}
-| routes_of_administration =
+| UNII = S9421HWB3Z
+| KEGG_Ref = {{keggcite|changed|kegg}}
+| KEGG = D06877
+| ChEMBL_Ref = {{ebicite|changed|EBI}}
+| ChEMBL = 1200906
+| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
+| ChemSpiderID      = 5546
+<!--Chemical data-->
+| C=21 | H=34 | Br=1 | N=1 | O=3
+| smiles = OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-]
+| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChI          = 1S/C21H34NO3.BrH/c1-4-22(3,5-2)16-17-25-20(23)21(24,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19,24H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1
+| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
+| StdInChIKey       = UKLQXHUGTKWPSR-UHFFFAOYSA-M
 }}
+'''Oxyphenonium bromide''' is an [[antimuscarinic]] drug.  It is used to treat [[gastric ulcer|gastric]] and [[duodenal ulcer]]s and to relieve visceral spasms.<ref>{{cite web | url = https://www.drugbank.ca/drugs/DB00219 | title = Oxyphenonium | publisher = [[DrugBank]]}}</ref>
-'''Oxyphenonium bromide''' is an [[antimuscarinic]].
+==References==
+{{Reflist}}
-{{pharmacology-stub}}
 {{Drugs for functional gastrointestinal disorders}}
+{{Muscarinic acetylcholine receptor modulators}}
 [[Category:Muscarinic antagonists]]
 [[Category:Quaternary ammonium compounds]]
+[[Category:Bromides]]
+[[Category:Tertiary alcohols]]
+[[Category:Carboxylate esters]]
+{{gastrointestinal-drug-stub}}