(Translated by https://www.hiragana.jp/)
Oxyphenonium bromide: Difference between revisions - Wikipedia Jump to content

Oxyphenonium bromide: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
Mrug (talk | contribs)
interwiki
Importing Wikidata short description: "Chemical compound"
 
(38 intermediate revisions by 19 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| IUPAC_name = 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-''N,N''-diethyl-''N''-methylethanaminium bromide
| Watchedfields = changed
| image = Oxyphenonium bromide.png
| verifiedrevid = 379646056
| CAS_number = 50-10-2
| IUPAC_name = 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-''N,N''-diethyl-''N''-methylethanaminium bromide
| ATC_prefix = A03
| image = Oxyphenonium bromide.png
| ATC_suffix = AB03
<!--Clinical data-->
| PubChem = 5748
| DrugBank =
| tradename =
| Drugs.com = {{drugs.com|international|oxyphenonium-bromide}}
| smiles = OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-]
| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->
| C=21|H=34|Br=1|N=1|O=3
| pregnancy_US = <!-- A / B / C / D / X -->
| molecular_weight = 428.40 g/mol
| bioavailability =
| pregnancy_category =
| legal_AUえーゆー = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| protein_bound =
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| metabolism =
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =
<!--Identifiers-->
| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->
| CAS_number_Ref = {{cascite|correct|??}}
| pregnancy_US = <!-- A / B / C / D / X -->
| CAS_number = 50-10-2
| pregnancy_category=
| ATC_prefix = A03
| legal_AUえーゆー = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled-->
| ATC_suffix = AB03
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII -->
| PubChem = 5748
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C -->
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| DrugBank =
| UNII_Ref = {{fdacite|changed|FDA}}
| routes_of_administration =
| UNII = S9421HWB3Z
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = D06877
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200906
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 5546
<!--Chemical data-->
| C=21 | H=34 | Br=1 | N=1 | O=3
| smiles = OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-]
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C21H34NO3.BrH/c1-4-22(3,5-2)16-17-25-20(23)21(24,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19,24H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = UKLQXHUGTKWPSR-UHFFFAOYSA-M
}}
}}


'''Oxyphenonium bromide''' is an [[antimuscarinic]] drug. It is used to treat [[gastric ulcer|gastric]] and [[duodenal ulcer]]s and to relieve visceral spasms.<ref>{{cite web | url = https://www.drugbank.ca/drugs/DB00219 | title = Oxyphenonium | publisher = [[DrugBank]]}}</ref>
'''Oxyphenonium bromide''' is an [[antimuscarinic]].


==References==

{{Reflist}}
{{pharmacology-stub}}


{{Drugs for functional gastrointestinal disorders}}
{{Drugs for functional gastrointestinal disorders}}
{{Muscarinic acetylcholine receptor modulators}}


[[Category:Muscarinic antagonists]]
[[Category:Muscarinic antagonists]]
[[Category:Quaternary ammonium compounds]]
[[Category:Quaternary ammonium compounds]]
[[Category:Bromides]]
[[Category:Tertiary alcohols]]
[[Category:Carboxylate esters]]



{{gastrointestinal-drug-stub}}
[[pl:Oksyfenonium]]

Latest revision as of 11:09, 23 January 2023

Oxyphenonium bromide
Clinical data
AHFS/Drugs.comInternational Drug Names
ATC code
Identifiers
  • 2-(2-Cyclohexyl-2-hydroxy-2-phenylacetoxy)-N,N-diethyl-N-methylethanaminium bromide
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEMBL
CompTox Dashboard (EPA)
ECHA InfoCard100.000.010 Edit this at Wikidata
Chemical and physical data
FormulaC21H34BrNO3
Molar mass428.411 g·mol−1
3D model (JSmol)
  • OC(C(=O)OCC[N+](C)(CC)CC)(c1ccccc1)C2CCCCC2.[Br-]
  • InChI=1S/C21H34NO3.BrH/c1-4-22(3,5-2)16-17-25-20(23)21(24,18-12-8-6-9-13-18)19-14-10-7-11-15-19;/h6,8-9,12-13,19,24H,4-5,7,10-11,14-17H2,1-3H3;1H/q+1;/p-1 ☒N
  • Key:UKLQXHUGTKWPSR-UHFFFAOYSA-M ☒N
 ☒NcheckY (what is this?)  (verify)

Oxyphenonium bromide is an antimuscarinic drug. It is used to treat gastric and duodenal ulcers and to relieve visceral spasms.[1]

References[edit]

  1. ^ "Oxyphenonium". DrugBank.