Miocamycin: Difference between revisions

Page 1
Page 2
Content deleted Content added
Script assisted update of identifiers for the Chem/Drugbox validation project (updated: 'ChEMBL').
Add: s2cid. | Use this bot. Report bugs. | #UCB_CommandLine 43/733
 
(14 intermediate revisions by 13 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| verifiedrevid = 400313461
| verifiedrevid = 444015174
| IUPAC_name = (2''S'',3''S'',4''R'',6''S'')-6-{[(2''R'',3''S'',4''R'',5''R'',6''S'')-6-{[(4''S'',5''R'',6''S'',7''R'',9''R'',10''R'',11''E'',13''E'',16''R'')-10-(acetyloxy)-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)-4-propoxy-1-oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydroxy-2-methyloxan-3-yl]oxy}-2,4-dimethyl-3-propoxyoxan-4-yl acetate
| IUPAC_name = (2''S'',3''S'',4''R'',6''S'')-6-<nowiki/>{[(2''R'',3''S'',4''R'',5''R'',6''S'')-6-<nowiki/>{[(4''S'',5''R'',6''S'',7''R'',9''R'',10''R'',11''E'',13''E'',16''R'')-10-(acetyloxy)-5-methoxy-9,16-dimethyl-2-oxo-7-(2-oxoethyl)-4-propoxy-1-oxacyclohexadeca-11,13-dien-6-yl]oxy}-4-(dimethylamino)-5-hydroxy-2-methyloxan-3-yl]oxy}-2,4-dimethyl-3-propoxyoxan-4-yl acetate
| image = Miocamycin.png
| image = Miocamycin.png
| InChI = 1/C45H71NO17/c1-13-34(50)59-33-23-36(52)55-26(4)18-16-15-17-19-32(58-29(7)48)25(3)22-31(20-21-47)41(42(33)54-12)62-44-39(53)38(46(10)11)40(27(5)57-44)61-37-24-45(9,63-30(8)49)43(28(6)56-37)60-35(51)14-2/h15-17,19,21,25-28,31-33,37-44,53H,13-14,18,20,22-24H2,1-12H3/b16-15+,19-17+/t25-,26-,27-,28+,31+,32+,33-,37+,38-,39-,40-,41+,42+,43+,44+,45-/m1/s1

| InChIKey = GQNZGCARKRHPOH-RQIKCTSVBA
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|miocamycin}}
| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AUえーゆー = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number = 55881-07-7
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 3T48CPS7U2
| ATC_prefix = J01
| ATC_suffix = FA11
| PubChem = 6475694
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 16735908
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1091024

<!--Chemical data-->
| C=45 | H=71 | N=1 | O=17
| smiles = CC(=O)O[C@H]3/C=C/C=C/C[C@@H](C)OC(=O)C[C@@H](OC(=O)CC)[C@H](OC)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]1C[C@@](C)(OC(C)=O)[C@@H](OC(=O)CC)[C@H](C)O1)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@H]3C
| smiles = CC(=O)O[C@H]3/C=C/C=C/C[C@@H](C)OC(=O)C[C@@H](OC(=O)CC)[C@H](OC)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O[C@H]1C[C@@](C)(OC(C)=O)[C@@H](OC(=O)CC)[C@H](C)O1)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@H]3C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
Line 10: Line 46:
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GQNZGCARKRHPOH-RQIKCTSVSA-N
| StdInChIKey = GQNZGCARKRHPOH-RQIKCTSVSA-N
| melting_point = 220
| CAS_number = 55881-07-7
| solubility = Slightly soluble in water; Soluble in methanol, acetone and chloroform.
| ATC_prefix = J01
| ATC_suffix = FA11
| ChEMBL = 1091024
| PubChem = 6475694
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID=16735908
| DrugBank =
| C=45|H=75|N=1|O=15
| molecular_weight = 870.075 g/mol
| solubility = Slightly soluble in water; Soluble in methanol, acetone and chloroform.
| melting_point = 220
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category=
| legal_AUえーゆー = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Miocamycin''' is a [[macrolide]] antibiotic.<ref name="pmid7506653">{{cite journal | vauthors = Holliday SM, Faulds D | title = Miocamycin. A review of its antimicrobial activity, pharmacokinetic properties and therapeutic potential | journal = Drugs | volume = 46 | issue = 4 | pages = 720–45 | date = October 1993 | pmid = 7506653 | doi = 10.2165/00003495-199346040-00008 | s2cid = 195692285 }}</ref> It has a spectrum activity similar to that of [[Erythromycin]], but shows higher antimicrobial effect against certain bacteria including [[Legionella pneumophila]] (the causative agent of [[Legionnaires' disease|Legionnaires' Disease]]), [[Mycoplasma hominis]], and [[Ureaplasma urealyticum]].<ref name="pmid7506653" /> In-vivo studies have further expounded on Miocamycin's efficacy, reporting that the medication is more effective than in-vitro data suggests.<ref>{{Cite journal |last=Lyseng-Williamson |first=Katherine A |date=June 2006 |title=Miocamycin is an effective option in the treatment of various bacterial infections |url=http://link.springer.com/10.2165/00042310-200622060-00001 |journal=Drugs & Therapy Perspectives |language=en |volume=22 |issue=6 |pages=1–6 |doi=10.2165/00042310-200622060-00001 |s2cid=72178165 |issn=1172-0360}}</ref>
'''Miocamycin''' is a [[macrolide]] antibiotic.



== References ==
{{Reflist}}


{{Macrolides, lincosamides and streptogramins}}
{{Macrolides, lincosamides and streptogramins}}


[[Category:Macrolide antibiotics]]
[[Category:Macrolide antibiotics]]
[[Category:Propionates]]
[[Category:Propionate esters]]
[[Category:Acetate esters]]
[[Category:Acetate esters]]




{{antibiotic-stub}}
{{antibiotic-stub}}

[[zh:霉素]]