Proquazone: Difference between revisions

{{short description|Nonsteroidal anti-inflammatory drug}}

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 376116641

| IUPAC_name = 1-isopropyl-7-methyl-4-phenylquinazolin-2(1''H'')-one

| image = proquazone.png

<!--Clinical data-->

| tradename =

| pregnancy_AUえーゆー = <!-- A / B1 / B2 / B3 / C / D / X -->

| pregnancy_US = <!-- A / B / C / D / X -->

| pregnancy_category =

| legal_AUえーゆー = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->

| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->

| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->

| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->

| legal_status =

| routes_of_administration =

<!--Pharmacokinetic data-->

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

<!--Identifiers-->

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 22760-18-5

| ATC_prefix = M01

| ATC_suffix = AX13

| PubChem = 31508

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 42VPJ2980S

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 268501

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 29222

<!--Chemical data-->

| C=18 | H=18 | N=2 | O=1

| smiles = CC1=CC2=C(C=C1)C(=NC(=O)N2C(C)C)C3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H18N2O/c1-12(2)20-16-11-13(3)9-10-15(16)17(19-18(20)21)14-7-5-4-6-8-14/h4-12H,1-3H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JTIGKVIOEQASGT-UHFFFAOYSA-N

'''Proquazone''' is a [[nonsteroidal anti-inflammatory drug]], known as an NSAID.<ref name=SpringerLinkArticle>{{cite journal | vauthors = Clissold SP, Beresford R | title = Proquazone. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic efficacy in rheumatic diseases and pain states | journal = Drugs | volume = 33 | issue = 5 | pages = 478–502 | date = May 1987 | pmid = 3297621 | doi = 10.2165/00003495-198733050-00004 | s2cid = 195697106 }}</ref>

==Uses==

Proquazone is used to treat [[rheumatoid arthritis]], [[osteoarthritis]] and [[ankylosing spondylitis]].<ref name="SpringerLinkArticle" /> It has been trialed for use as pain relief for tension headaches.<ref name="Headache Trial">{{cite journal | vauthors = DiSerio FJ, Friedman AP, Parno J, Singer JM | title = Proquazone for tension headache--a multicenter trial | journal = Headache | volume = 25 | issue = 3 | pages = 127–133 | date = May 1985 | pmid = 3891682 | doi = 10.1111/j.1526-4610.1985.hed2503127.x | s2cid = 9283866 }}</ref>

The recommended adult dose is around 450mg.<ref name="SpringerLinkArticle" />

===Side Effects===

Often, use of Proquazone is associated with [[diarrhea]] (up to 30% of the time).<ref name="SpringerLinkArticle" />

== References ==

{{Reflist}}

{{Anti-inflammatory and antirheumatic products|state=collapsed}}

[[Category:Quinazolinones]]

[[Category:Ureas]]