Proquazone: Difference between revisions
Appearance
Content deleted Content added
m Stub sorting and placement of stub template(s) |
m v2.05b - Bot T20 CW#61 - Fix errors for CW project (Reference before punctuation - Link equal to linktext) |
||
(35 intermediate revisions by 22 users not shown) | |||
Line 1: | Line 1: | ||
{{short description|Nonsteroidal anti-inflammatory drug}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| verifiedrevid = 376116641 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| tradename = |
|||
⚫ | |||
⚫ | |||
| molecular_weight = 278.34832 g/mol |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| metabolism = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| |
| metabolism = |
||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|changed|??}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
⚫ | |||
| UNII_Ref = {{fdacite|changed|FDA}} |
|||
| UNII = 42VPJ2980S |
|||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 268501 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 29222 |
|||
<!--Chemical data--> |
|||
⚫ | |||
| smiles = CC1=CC2=C(C=C1)C(=NC(=O)N2C(C)C)C3=CC=CC=C3 |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C18H18N2O/c1-12(2)20-16-11-13(3)9-10-15(16)17(19-18(20)21)14-7-5-4-6-8-14/h4-12H,1-3H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = JTIGKVIOEQASGT-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Proquazone''' is a [[nonsteroidal anti-inflammatory drug]], known as an NSAID.<ref name=SpringerLinkArticle>{{cite journal | vauthors = Clissold SP, Beresford R | title = Proquazone. A review of its pharmacodynamic and pharmacokinetic properties, and therapeutic efficacy in rheumatic diseases and pain states | journal = Drugs | volume = 33 | issue = 5 | pages = 478–502 | date = May 1987 | pmid = 3297621 | doi = 10.2165/00003495-198733050-00004 | s2cid = 195697106 }}</ref> |
|||
'''Proquazone''' is a [[non-steroidal anti-inflammatory drug]]. |
|||
==Uses== |
|||
Proquazone is used to treat [[rheumatoid arthritis]], [[osteoarthritis]] and [[ankylosing spondylitis]].<ref name="SpringerLinkArticle" /> It has been trialed for use as pain relief for tension headaches.<ref name="Headache Trial">{{cite journal | vauthors = DiSerio FJ, Friedman AP, Parno J, Singer JM | title = Proquazone for tension headache--a multicenter trial | journal = Headache | volume = 25 | issue = 3 | pages = 127–133 | date = May 1985 | pmid = 3891682 | doi = 10.1111/j.1526-4610.1985.hed2503127.x | s2cid = 9283866 }}</ref> |
|||
The recommended adult dose is around 450mg.<ref name="SpringerLinkArticle" /> |
|||
===Side Effects=== |
|||
Often, use of Proquazone is associated with [[diarrhea]] (up to 30% of the time).<ref name="SpringerLinkArticle" /> |
|||
== References == |
|||
⚫ | |||
{{ |
{{Reflist}} |
||
⚫ | |||
⚫ | |||
⚫ | |||
[[Category:ureas]] |
|||
⚫ | |||
⚫ | |||
{{musculoskeletal-drug-stub}} |
{{musculoskeletal-drug-stub}} |