Tilbroquinol: Difference between revisions
Content deleted Content added
m Dated {{Unreferenced}}. (Build p613) |
|||
| (17 intermediate revisions by 15 users not shown) | |||
| Line 1: | Line 1: | ||
{{Short description|Antiprotozoal agent}} |
|||
{{Wikify|date=May 2011}} |
|||
{{Unreferenced|date=September 2011}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
| Watchedfields = changed |
| Watchedfields = changed |
||
| verifiedrevid = |
| verifiedrevid = 451233341 |
||
| IUPAC_name = 7-Bromo-5-methylquinolin-8-ol |
| IUPAC_name = 7-Bromo-5-methylquinolin-8-ol |
||
| image = tilbroquinol.png |
| image = tilbroquinol.png |
||
| alt = Skeletal formula of tilbroquinol |
|||
| width = 150 |
| width = 150 |
||
| image2 = Tilbroquinol 3D ball.png |
|||
| alt2 = Ball-and-stick model of the tilbroquinol molecule |
|||
| width2 = 160 |
|||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = |
| tradename = |
||
| Drugs.com = {{Drugs.com|international|tilbroquinol}} |
|||
| pregnancy_ |
| pregnancy_ |
||
| pregnancy_US = <!-- A / B / C / D / X --> |
| pregnancy_US = <!-- A / B / C / D / X --> |
||
| Line 19: | Line 23: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = |
| routes_of_administration = |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = |
| bioavailability = |
||
| Line 26: | Line 29: | ||
| elimination_half-life = |
| elimination_half-life = |
||
| excretion = |
| excretion = |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| CAS_number_Ref = {{cascite|correct|??}} |
|||
| CAS_number = 7175-09-9 |
| CAS_number = 7175-09-9 |
||
| ATC_prefix = P01 |
| ATC_prefix = P01 |
||
| Line 34: | Line 37: | ||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = |
| DrugBank = |
||
| ChEMBL_Ref = {{ebicite|changed|EBI}} |
|||
| ChEMBL = 1788385 |
|||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = P6SB125NHA |
| UNII = P6SB125NHA |
||
| KEGG_Ref = {{keggcite|correct|kegg}} |
| KEGG_Ref = {{keggcite|correct|kegg}} |
||
| KEGG = D07351 |
| KEGG = D07351 |
||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 59034 |
|||
| smiles = CC1=CC(=C(C2=C1C=CC=N2)O)Br |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C10H8BrNO/c1-6-5-8(11)10(13)9-7(6)3-2-4-12-9/h2-5,13H,1H3 |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = JMOVFFLYGIQXMM-UHFFFAOYSA-N |
|||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=10 | H=8 | Br=1 | N=1 | O=1 |
| C=10 | H=8 | Br=1 | N=1 | O=1 |
||
| molecular_weight = 238.08 g/mol |
|||
}} |
}} |
||
'''Tilbroquinol''' is an [[antiprotozoal agent]] effective against [[amoebiasis]].<ref>{{Drugs.com|international|tilbroquinol}}</ref> It has also been used against ''[[Vibrio cholerae]]''.<ref>{{cite journal | vauthors = Bougoudogo F, Fournier JM, Dodin A | title = [In vitro sensitivity of Vibrio cholerae serotype 0:139 to an intestinal antiseptic tiliquinol-tilbroquinol combination] | journal = Bulletin de la Société de Pathologie Exotique | volume = 87 | issue = 1 | pages = 38–40 | year = 1994 | pmid = 8003903 }}</ref> |
|||
'''Tilbroquinol''' is an [[antiprotozoal agent]]. |
|||
== References == |
|||
{{reflist}} |
|||
{{Agents against amoebozoa}} |
{{Agents against amoebozoa}} |
||
| ⚫ | |||
[[Category:Quinolines]] |
|||
[[Category:Antiprotozoal agents]] |
[[Category:Antiprotozoal agents]] |
||
[[Category: |
[[Category:Bromoarenes]] |
||
| ⚫ | |||