Bornane: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
 {{distinguish|borane}}
 {{chembox
+| Verifiedfields = changed
-| verifiedrevid = 383251342
+| verifiedrevid = 439346674
-|  ImageFileL1 = bornane.svg
+| ImageFileL1 = bornane.svg
-|  ImageSizeL1 = 120
-|  ImageNameL1 = Skeletal formula
+| ImageNameL1 = Skeletal formula
-|  ImageFileR1 = Bornane-3D-balls.png
+| ImageFileR1 = Bornane-3D-balls.png
+| ImageNameR1 = Ball-and-stick model
-|  ImageSizeR1 = 120
+| IUPACName = (1S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane
-|  ImageNameR1 = Ball-and-stick model
+| OtherNames =
-|  IUPACName = (1S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptane
-|  OtherNames =
 |Section1={{Chembox Identifiers
+| CASNo_Ref = {{cascite|changed|??}}
-|  CASNo=
+| CASNo= 464-15-3
-|  PubChem=92108
+| PubChem=92108
-|  SMILES=CC1(C2CCC1(CC2)C)C
+| ChemSpiderID = 83155
+| Beilstein = 1900804
+| ChEBI = 35783
+| DrugBank = DB04501
+| StdInChI=1S/C10H18/c1-9(2)8-4-6-10(9,3)7-5-8/h8H,4-7H2,1-3H3
+| StdInChIKey = BEWYHVAWEKZDPP-UHFFFAOYSA-N
+| SMILES=CC1(C2CCC1(CC2)C)C
   }}
 |Section2={{Chembox Properties
-|  Formula=C<sub>10</sub>H<sub>18</sub>
+| Formula=C<sub>10</sub>H<sub>18</sub>
-|  MolarMass=138.24992
+| MolarMass=138.24992
-|  Appearance=
+| Appearance=
-|  Density=
+| Density=
-|  MeltingPt=
+| MeltingPt=
-|  BoilingPt=
+| BoilingPt=
-|  Solubility=
+| Solubility=
   }}
 |Section3={{Chembox Hazards
-|  MainHazards=
+| MainHazards=
-|  FlashPt=
+| FlashPt=
+| AutoignitionPt =
-|  Autoignition=
   }}
 }}
 '''Bornane''' (or '''camphane''') is a compound closely related to [[norbornane]].
+Its name refers to [[Borneo]], habitat of the tree ''[[Cinnamomum camphora]]'' from which bornane and related compounds can be extracted.
 ==See also==
@@ Line 36: / Line 44: @@
 [[Category:Monoterpenes]]
+[[Category:Bicyclic compounds]]
 {{hydrocarbon-stub}}
-[[es:Bornano]]
-[[hu:Bornán]]
-[[nl:Bornaan]]